About N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide
N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide (PubChem CID 130683927) has the molecular formula C8H10BrF2NO
and a molecular weight of 254.07 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide |
| PubChem CID | 130683927 |
| Molecular Formula | C8H10BrF2NO |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide |
| SMILES | C=C(Br)CNC(=O)C1CC(F)(F)C1 |
| InChI | InChI=1S/C8H10BrF2NO/c1-5(9)4-12-7(13)6-2-8(10,11)3-6/h6H,1-4H2,(H,12,13) |
| InChIKey | VUYKCXDZLIIVPB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide?
The IUPAC name of N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide (CID 130683927) is N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide.
What is the SMILES notation for N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide?
The canonical SMILES for N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide is C=C(Br)CNC(=O)C1CC(F)(F)C1.
What is the InChIKey of N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide?
The InChIKey is VUYKCXDZLIIVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrF2NO/c1-5(9)4-12-7(13)6-2-8(10,11)3-6/h6H,1-4H2,(H,12,13).
What are the key properties of N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide?
N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide has a molecular weight of 254.07 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoprop-2-enyl)-3,3-difluorocyclobutane-1-carboxamide is sourced from PubChem (CID 130683927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).