C10H13FN2 — CID 130684002
2-[(3-fluoroazetidin-1-yl)methyl]-3-methylpyridine (PubChem CID 130684002) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is 2-[(3-fluoroazetidin-1-yl)methyl]-3-methylpyridine.
| Compound Name | 2-[(3-fluoroazetidin-1-yl)methyl]-3-methylpyridine |
|---|---|
| PubChem CID | 130684002 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 2-[(3-fluoroazetidin-1-yl)methyl]-3-methylpyridine |
| SMILES | Cc1cccnc1CN1CC(F)C1 |
| InChI | InChI=1S/C10H13FN2/c1-8-3-2-4-12-10(8)7-13-5-9(11)6-13/h2-4,9H,5-7H2,1H3 |
| InChIKey | IXLUWAXOYYKBQI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |