About 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one
3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one (PubChem CID 130684865) has the molecular formula C9H12BrNO2
and a molecular weight of 246.10 g/mol. Its IUPAC name is 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one.
Molecular Properties
| Compound Name | 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one |
| PubChem CID | 130684865 |
| Molecular Formula | C9H12BrNO2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one |
| SMILES | O=C1OCCC1N1CCC=C(Br)C1 |
| InChI | InChI=1S/C9H12BrNO2/c10-7-2-1-4-11(6-7)8-3-5-13-9(8)12/h2,8H,1,3-6H2 |
| InChIKey | GWFKQEPSWDPHOZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one?
The IUPAC name of 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one (CID 130684865) is 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one.
What is the SMILES notation for 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one?
The canonical SMILES for 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one is O=C1OCCC1N1CCC=C(Br)C1.
What is the InChIKey of 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one?
The InChIKey is GWFKQEPSWDPHOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrNO2/c10-7-2-1-4-11(6-7)8-3-5-13-9(8)12/h2,8H,1,3-6H2.
What are the key properties of 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one?
3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one has a molecular weight of 246.10 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-3,6-dihydro-2H-pyridin-1-yl)oxolan-2-one is sourced from PubChem (CID 130684865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).