C8H11NO2S — CID 130685032
2-hydroxy-N-[(5-methylthiophen-2-yl)methyl]acetamide (PubChem CID 130685032) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-hydroxy-N-[(5-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-hydroxy-N-[(5-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 130685032 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 2-hydroxy-N-[(5-methylthiophen-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CO)s1 |
| InChI | InChI=1S/C8H11NO2S/c1-6-2-3-7(12-6)4-9-8(11)5-10/h2-3,10H,4-5H2,1H3,(H,9,11) |
| InChIKey | JGUIPVKXMZJHBJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |