C8H12ClF2NO — CID 130685067
2-chloro-1-(3-ethyl-3-methylazetidin-1-yl)-2,2-difluoroethanone (PubChem CID 130685067) has the molecular formula C8H12ClF2NO and a molecular weight of 211.64 g/mol. Its IUPAC name is 2-chloro-1-(3-ethyl-3-methylazetidin-1-yl)-2,2-difluoroethanone.
| Compound Name | 2-chloro-1-(3-ethyl-3-methylazetidin-1-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 130685067 |
| Molecular Formula | C8H12ClF2NO |
| Molecular Weight | 211.64 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2-chloro-1-(3-ethyl-3-methylazetidin-1-yl)-2,2-difluoroethanone |
| SMILES | CCC1(C)CN(C(=O)C(F)(F)Cl)C1 |
| InChI | InChI=1S/C8H12ClF2NO/c1-3-7(2)4-12(5-7)6(13)8(9,10)11/h3-5H2,1-2H3 |
| InChIKey | QFXFFMNETHRWOB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.64 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|