C8H14N6 — CID 130685335
6-(pyrrolidin-1-ylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 130685335) has the molecular formula C8H14N6 and a molecular weight of 194.24 g/mol. Its IUPAC name is 6-(pyrrolidin-1-ylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(pyrrolidin-1-ylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 130685335 |
| Molecular Formula | C8H14N6 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 6-(pyrrolidin-1-ylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(CN2CCCC2)n1 |
| InChI | InChI=1S/C8H14N6/c9-7-11-6(12-8(10)13-7)5-14-3-1-2-4-14/h1-5H2,(H4,9,10,11,12,13) |
| InChIKey | QCVUZLLJSYIITD-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |