About 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile
2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile (PubChem CID 130685452) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile.
Molecular Properties
| Compound Name | 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile |
| PubChem CID | 130685452 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile |
| SMILES | CN(CC#N)CN1C(=O)CC1(C)C |
| InChI | InChI=1S/C9H15N3O/c1-9(2)6-8(13)12(9)7-11(3)5-4-10/h5-7H2,1-3H3 |
| InChIKey | UJKUUMHKFDVJGH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile?
The IUPAC name of 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile (CID 130685452) is 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile.
What is the SMILES notation for 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile?
The canonical SMILES for 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile is CN(CC#N)CN1C(=O)CC1(C)C.
What is the InChIKey of 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile?
The InChIKey is UJKUUMHKFDVJGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-9(2)6-8(13)12(9)7-11(3)5-4-10/h5-7H2,1-3H3.
What are the key properties of 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile?
2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile has a molecular weight of 181.24 g/mol, XLogP of 0.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dimethyl-4-oxoazetidin-1-yl)methyl-methylamino]acetonitrile is sourced from PubChem (CID 130685452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).