About 3-methyl-5-propoxy-1,2,4-oxadiazole
3-methyl-5-propoxy-1,2,4-oxadiazole (PubChem CID 130685565) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 3-methyl-5-propoxy-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-methyl-5-propoxy-1,2,4-oxadiazole |
| PubChem CID | 130685565 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 3-methyl-5-propoxy-1,2,4-oxadiazole |
| SMILES | CCCOc1nc(C)no1 |
| InChI | InChI=1S/C6H10N2O2/c1-3-4-9-6-7-5(2)8-10-6/h3-4H2,1-2H3 |
| InChIKey | UUVLBMFLRSSCTL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-5-propoxy-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-propoxy-1,2,4-oxadiazole?
The IUPAC name of 3-methyl-5-propoxy-1,2,4-oxadiazole (CID 130685565) is 3-methyl-5-propoxy-1,2,4-oxadiazole.
What is the SMILES notation for 3-methyl-5-propoxy-1,2,4-oxadiazole?
The canonical SMILES for 3-methyl-5-propoxy-1,2,4-oxadiazole is CCCOc1nc(C)no1.
What is the InChIKey of 3-methyl-5-propoxy-1,2,4-oxadiazole?
The InChIKey is UUVLBMFLRSSCTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-3-4-9-6-7-5(2)8-10-6/h3-4H2,1-2H3.
What are the key properties of 3-methyl-5-propoxy-1,2,4-oxadiazole?
3-methyl-5-propoxy-1,2,4-oxadiazole has a molecular weight of 142.16 g/mol, XLogP of 1.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-propoxy-1,2,4-oxadiazole is sourced from PubChem (CID 130685565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).