About 3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine
3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine (PubChem CID 130685662) has the molecular formula C8H13N3OS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine.
Analyze 3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine?
The IUPAC name of 3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine (CID 130685662) is 3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine.
What is the SMILES notation for 3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine?
The canonical SMILES for 3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine is Cc1nsc(N2CCOCC2C)n1.
What is the InChIKey of 3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine?
The InChIKey is NYIDHFYIZKZXLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3OS/c1-6-5-12-4-3-11(6)8-9-7(2)10-13-8/h6H,3-5H2,1-2H3.
What are the key properties of 3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine?
3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine has a molecular weight of 199.28 g/mol, XLogP of 1.07, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(3-methyl-1,2,4-thiadiazol-5-yl)morpholine is sourced from PubChem (CID 130685662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).