About 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide
2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide (PubChem CID 130685788) has the molecular formula C8H11FN2O2
and a molecular weight of 186.19 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide.
Molecular Properties
| Compound Name | 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide |
| PubChem CID | 130685788 |
| Molecular Formula | C8H11FN2O2 |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide |
| SMILES | CC(C)C(F)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C8H11FN2O2/c1-5(2)7(9)8(12)10-6-3-4-13-11-6/h3-5,7H,1-2H3,(H,10,11,12) |
| InChIKey | GCQNXPFYKCUSCT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide?
The IUPAC name of 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide (CID 130685788) is 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide.
What is the SMILES notation for 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide?
The canonical SMILES for 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide is CC(C)C(F)C(=O)Nc1ccon1.
What is the InChIKey of 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide?
The InChIKey is GCQNXPFYKCUSCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2O2/c1-5(2)7(9)8(12)10-6-3-4-13-11-6/h3-5,7H,1-2H3,(H,10,11,12).
What are the key properties of 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide?
2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide has a molecular weight of 186.19 g/mol, XLogP of 1.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-methyl-N-(1,2-oxazol-3-yl)butanamide is sourced from PubChem (CID 130685788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).