About 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole
5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole (PubChem CID 130686295) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole |
| PubChem CID | 130686295 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CCOc1nc(C(C)C)no1 |
| InChI | InChI=1S/C7H12N2O2/c1-4-10-7-8-6(5(2)3)9-11-7/h5H,4H2,1-3H3 |
| InChIKey | LQRFVRVAALDATI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole?
The IUPAC name of 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole (CID 130686295) is 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole.
What is the SMILES notation for 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole?
The canonical SMILES for 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole is CCOc1nc(C(C)C)no1.
What is the InChIKey of 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole?
The InChIKey is LQRFVRVAALDATI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-4-10-7-8-6(5(2)3)9-11-7/h5H,4H2,1-3H3.
What are the key properties of 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole?
5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole has a molecular weight of 156.18 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-3-propan-2-yl-1,2,4-oxadiazole is sourced from PubChem (CID 130686295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).