C8H13FN4 — CID 130686526
8-(2-fluoroethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepine (PubChem CID 130686526) has the molecular formula C8H13FN4 and a molecular weight of 184.22 g/mol. Its IUPAC name is 8-(2-fluoroethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepine.
| Compound Name | 8-(2-fluoroethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepine |
|---|---|
| PubChem CID | 130686526 |
| Molecular Formula | C8H13FN4 |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 8-(2-fluoroethyl)-5,6,7,9-tetrahydro-[1,2,4]triazolo[4,3-a][1,4]diazepine |
| SMILES | FCCN1CCCn2cnnc2C1 |
| InChI | InChI=1S/C8H13FN4/c9-2-5-12-3-1-4-13-7-10-11-8(13)6-12/h7H,1-6H2 |
| InChIKey | XPJCTHJPKNCFKY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |