About 1-fluoroanthracene
1-fluoroanthracene (PubChem CID 13068655) has the molecular formula C14H9F
and a molecular weight of 196.22 g/mol. Its IUPAC name is 1-fluoroanthracene.
Molecular Properties
| Compound Name | 1-fluoroanthracene |
| PubChem CID | 13068655 |
| Molecular Formula | C14H9F |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-fluoroanthracene |
| SMILES | Fc1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C14H9F/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H |
| InChIKey | JBYLHICABMOUQN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroanthracene?
The IUPAC name of 1-fluoroanthracene (CID 13068655) is 1-fluoroanthracene.
What is the SMILES notation for 1-fluoroanthracene?
The canonical SMILES for 1-fluoroanthracene is Fc1cccc2cc3ccccc3cc12.
What is the InChIKey of 1-fluoroanthracene?
The InChIKey is JBYLHICABMOUQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H.
What are the key properties of 1-fluoroanthracene?
1-fluoroanthracene has a molecular weight of 196.22 g/mol, XLogP of 4.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroanthracene is sourced from PubChem (CID 13068655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).