About 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide
2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide (PubChem CID 130687209) has the molecular formula C5H7F2N3O2S2
and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide |
| PubChem CID | 130687209 |
| Molecular Formula | C5H7F2N3O2S2 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cnc(NCC(F)F)s1 |
| InChI | InChI=1S/C5H7F2N3O2S2/c6-3(7)1-9-5-10-2-4(13-5)14(8,11)12/h2-3H,1H2,(H,9,10)(H2,8,11,12) |
| InChIKey | CDAPMLKHFWHWNW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide (CID 130687209) is 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide is NS(=O)(=O)c1cnc(NCC(F)F)s1.
What is the InChIKey of 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide?
The InChIKey is CDAPMLKHFWHWNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F2N3O2S2/c6-3(7)1-9-5-10-2-4(13-5)14(8,11)12/h2-3H,1H2,(H,9,10)(H2,8,11,12).
What are the key properties of 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide?
2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide has a molecular weight of 243.26 g/mol, XLogP of 0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethylamino)-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 130687209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).