About 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea
1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea (PubChem CID 130688509) has the molecular formula C9H17FN2O
and a molecular weight of 188.25 g/mol. Its IUPAC name is 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea.
Molecular Properties
| Compound Name | 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea |
| PubChem CID | 130688509 |
| Molecular Formula | C9H17FN2O |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea |
| SMILES | CCN(C)C(=O)N[C@H]1CCC[C@H]1F |
| InChI | InChI=1S/C9H17FN2O/c1-3-12(2)9(13)11-8-6-4-5-7(8)10/h7-8H,3-6H2,1-2H3,(H,11,13)/t7-,8+/m1/s1 |
| InChIKey | JIQVIYYAJUMMHI-SFYZADRCSA-N |
| XLogP | 1.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea?
The IUPAC name of 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea (CID 130688509) is 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea.
What is the SMILES notation for 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea?
The canonical SMILES for 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea is CCN(C)C(=O)N[C@H]1CCC[C@H]1F.
What is the InChIKey of 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea?
The InChIKey is JIQVIYYAJUMMHI-SFYZADRCSA-N. The full InChI is InChI=1S/C9H17FN2O/c1-3-12(2)9(13)11-8-6-4-5-7(8)10/h7-8H,3-6H2,1-2H3,(H,11,13)/t7-,8+/m1/s1.
What are the key properties of 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea?
1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea has a molecular weight of 188.25 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea is sourced from PubChem (CID 130688509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).