C9H17FN2O — CID 130688509
1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea (PubChem CID 130688509) has the molecular formula C9H17FN2O and a molecular weight of 188.25 g/mol. Its IUPAC name is 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea.
| Compound Name | 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea |
|---|---|
| PubChem CID | 130688509 |
| Molecular Formula | C9H17FN2O |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-ethyl-3-[(1S,2R)-2-fluorocyclopentyl]-1-methylurea |
| SMILES | CCN(C)C(=O)N[C@H]1CCC[C@H]1F |
| InChI | InChI=1S/C9H17FN2O/c1-3-12(2)9(13)11-8-6-4-5-7(8)10/h7-8H,3-6H2,1-2H3,(H,11,13)/t7-,8+/m1/s1 |
| InChIKey | JIQVIYYAJUMMHI-SFYZADRCSA-N |
| XLogP | 1.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |