About anthracen-9-amine
anthracen-9-amine (PubChem CID 13069) has the molecular formula C14H11N
and a molecular weight of 193.25 g/mol. Its IUPAC name is anthracen-9-amine.
Molecular Properties
| Compound Name | anthracen-9-amine |
| PubChem CID | 13069 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | anthracen-9-amine |
| SMILES | Nc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C14H11N/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H,15H2 |
| InChIKey | LHNICELDCMPPDE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracen-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracen-9-amine?
The IUPAC name of anthracen-9-amine (CID 13069) is anthracen-9-amine.
What is the SMILES notation for anthracen-9-amine?
The canonical SMILES for anthracen-9-amine is Nc1c2ccccc2cc2ccccc12.
What is the InChIKey of anthracen-9-amine?
The InChIKey is LHNICELDCMPPDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H,15H2.
What are the key properties of anthracen-9-amine?
anthracen-9-amine has a molecular weight of 193.25 g/mol, XLogP of 3.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracen-9-amine is sourced from PubChem (CID 13069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).