About spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde
spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde (PubChem CID 130690308) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde.
Molecular Properties
| Compound Name | spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde |
| PubChem CID | 130690308 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde |
| SMILES | O=Cc1nc2c([nH]1)CCC21CCCCC1 |
| InChI | InChI=1S/C12H16N2O/c15-8-10-13-9-4-7-12(11(9)14-10)5-2-1-3-6-12/h8H,1-7H2,(H,13,14) |
| InChIKey | VBXZEEAHZJJLAR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde?
The IUPAC name of spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde (CID 130690308) is spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde.
What is the SMILES notation for spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde?
The canonical SMILES for spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde is O=Cc1nc2c([nH]1)CCC21CCCCC1.
What is the InChIKey of spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde?
The InChIKey is VBXZEEAHZJJLAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c15-8-10-13-9-4-7-12(11(9)14-10)5-2-1-3-6-12/h8H,1-7H2,(H,13,14).
What are the key properties of spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde?
spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde has a molecular weight of 204.27 g/mol, XLogP of 2.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[5,6-dihydro-1H-cyclopenta[d]imidazole-4,1'-cyclohexane]-2-carbaldehyde is sourced from PubChem (CID 130690308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).