About 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea
1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea (PubChem CID 130691207) has the molecular formula C9H17FN2O
and a molecular weight of 188.25 g/mol. Its IUPAC name is 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea |
| PubChem CID | 130691207 |
| Molecular Formula | C9H17FN2O |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea |
| SMILES | CCNC(=O)N[C@@H]1CCCC[C@H]1F |
| InChI | InChI=1S/C9H17FN2O/c1-2-11-9(13)12-8-6-4-3-5-7(8)10/h7-8H,2-6H2,1H3,(H2,11,12,13)/t7-,8-/m1/s1 |
| InChIKey | HFAOXHTURUZBCG-HTQZYQBOSA-N |
| XLogP | 1.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea?
The IUPAC name of 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea (CID 130691207) is 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea.
What is the SMILES notation for 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea?
The canonical SMILES for 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea is CCNC(=O)N[C@@H]1CCCC[C@H]1F.
What is the InChIKey of 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea?
The InChIKey is HFAOXHTURUZBCG-HTQZYQBOSA-N. The full InChI is InChI=1S/C9H17FN2O/c1-2-11-9(13)12-8-6-4-3-5-7(8)10/h7-8H,2-6H2,1H3,(H2,11,12,13)/t7-,8-/m1/s1.
What are the key properties of 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea?
1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea has a molecular weight of 188.25 g/mol, XLogP of 1.59, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[(1R,2R)-2-fluorocyclohexyl]urea is sourced from PubChem (CID 130691207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).