About (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide
(3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide (PubChem CID 13069152) has the molecular formula C5H5N5OS
and a molecular weight of 183.20 g/mol. Its IUPAC name is (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide.
Molecular Properties
| Compound Name | (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide |
| PubChem CID | 13069152 |
| Molecular Formula | C5H5N5OS |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide |
| SMILES | CO/N=C(\C#N)c1nsc(N)n1 |
| InChI | InChI=1S/C5H5N5OS/c1-11-9-3(2-6)4-8-5(7)12-10-4/h1H3,(H2,7,8,10)/b9-3+ |
| InChIKey | QUDFYUOLFVZVQB-YCRREMRBSA-N |
| XLogP | -0.01 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide?
The IUPAC name of (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide (CID 13069152) is (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide.
What is the SMILES notation for (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide?
The canonical SMILES for (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide is CO/N=C(\C#N)c1nsc(N)n1.
What is the InChIKey of (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide?
The InChIKey is QUDFYUOLFVZVQB-YCRREMRBSA-N. The full InChI is InChI=1S/C5H5N5OS/c1-11-9-3(2-6)4-8-5(7)12-10-4/h1H3,(H2,7,8,10)/b9-3+.
What are the key properties of (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide?
(3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide has a molecular weight of 183.20 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-amino-N-methoxy-1,2,4-thiadiazole-3-carboximidoyl cyanide is sourced from PubChem (CID 13069152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).