C7H9F2NOS — CID 130692072
(2R)-2-amino-2-[5-(difluoromethyl)thiophen-3-yl]ethanol (PubChem CID 130692072) has the molecular formula C7H9F2NOS and a molecular weight of 193.22 g/mol. Its IUPAC name is (2R)-2-amino-2-[5-(difluoromethyl)thiophen-3-yl]ethanol.
| Compound Name | (2R)-2-amino-2-[5-(difluoromethyl)thiophen-3-yl]ethanol |
|---|---|
| PubChem CID | 130692072 |
| Molecular Formula | C7H9F2NOS |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | (2R)-2-amino-2-[5-(difluoromethyl)thiophen-3-yl]ethanol |
| SMILES | N[C@@H](CO)c1csc(C(F)F)c1 |
| InChI | InChI=1S/C7H9F2NOS/c8-7(9)6-1-4(3-12-6)5(10)2-11/h1,3,5,7,11H,2,10H2/t5-/m0/s1 |
| InChIKey | RUGCAAGDRGULAB-YFKPBYRVSA-N |
| XLogP | 1.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |