About 2-(2-phenylethyl)furan
2-(2-phenylethyl)furan (PubChem CID 13069224) has the molecular formula C12H12O
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(2-phenylethyl)furan.
Molecular Properties
| Compound Name | 2-(2-phenylethyl)furan |
| PubChem CID | 13069224 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 2-(2-phenylethyl)furan |
| SMILES | c1ccc(CCc2ccco2)cc1 |
| InChI | InChI=1S/C12H12O/c1-2-5-11(6-3-1)8-9-12-7-4-10-13-12/h1-7,10H,8-9H2 |
| InChIKey | PPRMBHRATOCDLN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-phenylethyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylethyl)furan?
The IUPAC name of 2-(2-phenylethyl)furan (CID 13069224) is 2-(2-phenylethyl)furan.
What is the SMILES notation for 2-(2-phenylethyl)furan?
The canonical SMILES for 2-(2-phenylethyl)furan is c1ccc(CCc2ccco2)cc1.
What is the InChIKey of 2-(2-phenylethyl)furan?
The InChIKey is PPRMBHRATOCDLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O/c1-2-5-11(6-3-1)8-9-12-7-4-10-13-12/h1-7,10H,8-9H2.
What are the key properties of 2-(2-phenylethyl)furan?
2-(2-phenylethyl)furan has a molecular weight of 172.23 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethyl)furan is sourced from PubChem (CID 13069224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).