About (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine
(3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine (PubChem CID 130693092) has the molecular formula C9H11Cl2N3
and a molecular weight of 232.11 g/mol. Its IUPAC name is (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine |
| PubChem CID | 130693092 |
| Molecular Formula | C9H11Cl2N3 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine |
| SMILES | N[C@H]1CCN(c2cnc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C9H11Cl2N3/c10-8-3-7(4-13-9(8)11)14-2-1-6(12)5-14/h3-4,6H,1-2,5,12H2/t6-/m0/s1 |
| InChIKey | DCKRTBWQJQRMAG-LURJTMIESA-N |
| XLogP | 1.93 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine?
The IUPAC name of (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine (CID 130693092) is (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine.
What is the SMILES notation for (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine?
The canonical SMILES for (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine is N[C@H]1CCN(c2cnc(Cl)c(Cl)c2)C1.
What is the InChIKey of (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine?
The InChIKey is DCKRTBWQJQRMAG-LURJTMIESA-N. The full InChI is InChI=1S/C9H11Cl2N3/c10-8-3-7(4-13-9(8)11)14-2-1-6(12)5-14/h3-4,6H,1-2,5,12H2/t6-/m0/s1.
What are the key properties of (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine?
(3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine has a molecular weight of 232.11 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(5,6-dichloro-3-pyridinyl)pyrrolidin-3-amine is sourced from PubChem (CID 130693092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).