C7H12Cl3NO — CID 130693205
(3S)-1-(3,3,3-trichloropropyl)pyrrolidin-3-ol (PubChem CID 130693205) has the molecular formula C7H12Cl3NO and a molecular weight of 232.54 g/mol. Its IUPAC name is (3S)-1-(3,3,3-trichloropropyl)pyrrolidin-3-ol.
| Compound Name | (3S)-1-(3,3,3-trichloropropyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 130693205 |
| Molecular Formula | C7H12Cl3NO |
| Molecular Weight | 232.54 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | (3S)-1-(3,3,3-trichloropropyl)pyrrolidin-3-ol |
| SMILES | O[C@H]1CCN(CCC(Cl)(Cl)Cl)C1 |
| InChI | InChI=1S/C7H12Cl3NO/c8-7(9,10)2-4-11-3-1-6(12)5-11/h6,12H,1-5H2/t6-/m0/s1 |
| InChIKey | KHZJPVKVSPIXIT-LURJTMIESA-N |
| XLogP | 1.81 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.54 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|