About 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine
4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine (PubChem CID 130693268) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine |
| PubChem CID | 130693268 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine |
| SMILES | CCC(C)c1cs/c(=N\C)n1C |
| InChI | InChI=1S/C9H16N2S/c1-5-7(2)8-6-12-9(10-3)11(8)4/h6-7H,5H2,1-4H3/b10-9- |
| InChIKey | JHDBSEHOZNKHEW-KTKRTIGZSA-N |
| XLogP | 2.13 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine?
The IUPAC name of 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine (CID 130693268) is 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine.
What is the SMILES notation for 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine?
The canonical SMILES for 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine is CCC(C)c1cs/c(=N\C)n1C.
What is the InChIKey of 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine?
The InChIKey is JHDBSEHOZNKHEW-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H16N2S/c1-5-7(2)8-6-12-9(10-3)11(8)4/h6-7H,5H2,1-4H3/b10-9-.
What are the key properties of 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine?
4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine has a molecular weight of 184.31 g/mol, XLogP of 2.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-N,3-dimethyl-1,3-thiazol-2-imine is sourced from PubChem (CID 130693268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).