C11H21NO — CID 130693519
3-methyl-4-(2-methylidenebutyl)-1,4-oxazepane (PubChem CID 130693519) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 3-methyl-4-(2-methylidenebutyl)-1,4-oxazepane.
| Compound Name | 3-methyl-4-(2-methylidenebutyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 130693519 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 3-methyl-4-(2-methylidenebutyl)-1,4-oxazepane |
| SMILES | C=C(CC)CN1CCCOCC1C |
| InChI | InChI=1S/C11H21NO/c1-4-10(2)8-12-6-5-7-13-9-11(12)3/h11H,2,4-9H2,1,3H3 |
| InChIKey | UGMJGZBVYPBUKZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|