C10H19FN2O — CID 130693804
(3R,4R)-4-(3-fluoro-4-methylpiperidin-1-yl)pyrrolidin-3-ol (PubChem CID 130693804) has the molecular formula C10H19FN2O and a molecular weight of 202.27 g/mol. Its IUPAC name is (3R,4R)-4-(3-fluoro-4-methylpiperidin-1-yl)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-(3-fluoro-4-methylpiperidin-1-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 130693804 |
| Molecular Formula | C10H19FN2O |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (3R,4R)-4-(3-fluoro-4-methylpiperidin-1-yl)pyrrolidin-3-ol |
| SMILES | CC1CCN([C@@H]2CNC[C@H]2O)CC1F |
| InChI | InChI=1S/C10H19FN2O/c1-7-2-3-13(6-8(7)11)9-4-12-5-10(9)14/h7-10,12,14H,2-6H2,1H3/t7?,8?,9-,10-/m1/s1 |
| InChIKey | RSSPWPGZAVERLQ-YDYPAMBWSA-N |
| XLogP | -0.00 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |