About 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine
2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine (PubChem CID 130693891) has the molecular formula C8H9FN4
and a molecular weight of 180.19 g/mol. Its IUPAC name is 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine |
| PubChem CID | 130693891 |
| Molecular Formula | C8H9FN4 |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine |
| SMILES | Nc1nc(N2CC=CC2)ncc1F |
| InChI | InChI=1S/C8H9FN4/c9-6-5-11-8(12-7(6)10)13-3-1-2-4-13/h1-2,5H,3-4H2,(H2,10,11,12) |
| InChIKey | CXXPIIJOJREWGF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine?
The IUPAC name of 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine (CID 130693891) is 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine.
What is the SMILES notation for 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine?
The canonical SMILES for 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine is Nc1nc(N2CC=CC2)ncc1F.
What is the InChIKey of 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine?
The InChIKey is CXXPIIJOJREWGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN4/c9-6-5-11-8(12-7(6)10)13-3-1-2-4-13/h1-2,5H,3-4H2,(H2,10,11,12).
What are the key properties of 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine?
2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine has a molecular weight of 180.19 g/mol, XLogP of 0.57, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dihydropyrrol-1-yl)-5-fluoropyrimidin-4-amine is sourced from PubChem (CID 130693891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).