C5H6FN3OS — CID 130693984
N-(2-fluoroethyl)thiadiazole-5-carboxamide (PubChem CID 130693984) has the molecular formula C5H6FN3OS and a molecular weight of 175.19 g/mol. Its IUPAC name is N-(2-fluoroethyl)thiadiazole-5-carboxamide.
| Compound Name | N-(2-fluoroethyl)thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 130693984 |
| Molecular Formula | C5H6FN3OS |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | N-(2-fluoroethyl)thiadiazole-5-carboxamide |
| SMILES | O=C(NCCF)c1cnns1 |
| InChI | InChI=1S/C5H6FN3OS/c6-1-2-7-5(10)4-3-8-9-11-4/h3H,1-2H2,(H,7,10) |
| InChIKey | KUQISAVXKCUZLJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |