About 4-cyclopropylsulfanyl-1,2-difluorobenzene
4-cyclopropylsulfanyl-1,2-difluorobenzene (PubChem CID 130693987) has the molecular formula C9H8F2S
and a molecular weight of 186.23 g/mol. Its IUPAC name is 4-cyclopropylsulfanyl-1,2-difluorobenzene.
Molecular Properties
| Compound Name | 4-cyclopropylsulfanyl-1,2-difluorobenzene |
| PubChem CID | 130693987 |
| Molecular Formula | C9H8F2S |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 4-cyclopropylsulfanyl-1,2-difluorobenzene |
| SMILES | Fc1ccc(SC2CC2)cc1F |
| InChI | InChI=1S/C9H8F2S/c10-8-4-3-7(5-9(8)11)12-6-1-2-6/h3-6H,1-2H2 |
| InChIKey | ZHEBKPDKOJCXBD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclopropylsulfanyl-1,2-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropylsulfanyl-1,2-difluorobenzene?
The IUPAC name of 4-cyclopropylsulfanyl-1,2-difluorobenzene (CID 130693987) is 4-cyclopropylsulfanyl-1,2-difluorobenzene.
What is the SMILES notation for 4-cyclopropylsulfanyl-1,2-difluorobenzene?
The canonical SMILES for 4-cyclopropylsulfanyl-1,2-difluorobenzene is Fc1ccc(SC2CC2)cc1F.
What is the InChIKey of 4-cyclopropylsulfanyl-1,2-difluorobenzene?
The InChIKey is ZHEBKPDKOJCXBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F2S/c10-8-4-3-7(5-9(8)11)12-6-1-2-6/h3-6H,1-2H2.
What are the key properties of 4-cyclopropylsulfanyl-1,2-difluorobenzene?
4-cyclopropylsulfanyl-1,2-difluorobenzene has a molecular weight of 186.23 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropylsulfanyl-1,2-difluorobenzene is sourced from PubChem (CID 130693987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).