About 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one
3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one (PubChem CID 130694409) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one |
| PubChem CID | 130694409 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one |
| SMILES | CC1(Cn2ccsc2=O)COC1 |
| InChI | InChI=1S/C8H11NO2S/c1-8(5-11-6-8)4-9-2-3-12-7(9)10/h2-3H,4-6H2,1H3 |
| InChIKey | VBSFMSZRXMNBSQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one?
The IUPAC name of 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one (CID 130694409) is 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one.
What is the SMILES notation for 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one?
The canonical SMILES for 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one is CC1(Cn2ccsc2=O)COC1.
What is the InChIKey of 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one?
The InChIKey is VBSFMSZRXMNBSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-8(5-11-6-8)4-9-2-3-12-7(9)10/h2-3H,4-6H2,1H3.
What are the key properties of 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one?
3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one has a molecular weight of 185.25 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-methyloxetan-3-yl)methyl]-1,3-thiazol-2-one is sourced from PubChem (CID 130694409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).