About 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide
4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide (PubChem CID 130696117) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide |
| PubChem CID | 130696117 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide |
| SMILES | CCc1ncsc1C(=O)NO |
| InChI | InChI=1S/C6H8N2O2S/c1-2-4-5(6(9)8-10)11-3-7-4/h3,10H,2H2,1H3,(H,8,9) |
| InChIKey | GALWKNFRHAVMEG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide (CID 130696117) is 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide is CCc1ncsc1C(=O)NO.
What is the InChIKey of 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide?
The InChIKey is GALWKNFRHAVMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-2-4-5(6(9)8-10)11-3-7-4/h3,10H,2H2,1H3,(H,8,9).
What are the key properties of 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide?
4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide has a molecular weight of 172.21 g/mol, XLogP of 0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N-hydroxy-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 130696117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).