C19H34O2 — CID 13069693
(5E,7E)-14-methoxy-6,10,14-trimethylpentadeca-5,7-dien-4-one (PubChem CID 13069693) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is (5E,7E)-14-methoxy-6,10,14-trimethylpentadeca-5,7-dien-4-one.
| Compound Name | (5E,7E)-14-methoxy-6,10,14-trimethylpentadeca-5,7-dien-4-one |
|---|---|
| PubChem CID | 13069693 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | (5E,7E)-14-methoxy-6,10,14-trimethylpentadeca-5,7-dien-4-one |
| SMILES | CCCC(=O)/C=C(C)/C=C/CC(C)CCCC(C)(C)OC |
| InChI | InChI=1S/C19H34O2/c1-7-10-18(20)15-17(3)12-8-11-16(2)13-9-14-19(4,5)21-6/h8,12,15-16H,7,9-11,13-14H2,1-6H3/b12-8+,17-15+ |
| InChIKey | KERRDTAJVWEFTN-MSEWRAJFSA-N |
| XLogP | 5.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|