C9H8N2O2S — CID 130697506
2-(5-methylthiophen-3-yl)-1H-imidazole-5-carboxylic acid (PubChem CID 130697506) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is 2-(5-methylthiophen-3-yl)-1H-imidazole-5-carboxylic acid.
| Compound Name | 2-(5-methylthiophen-3-yl)-1H-imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 130697506 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 2-(5-methylthiophen-3-yl)-1H-imidazole-5-carboxylic acid |
| SMILES | Cc1cc(-c2ncc(C(=O)O)[nH]2)cs1 |
| InChI | InChI=1S/C9H8N2O2S/c1-5-2-6(4-14-5)8-10-3-7(11-8)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | ZSWIWAUSFONEET-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |