C9H19N3O — CID 130697867
(2S,5R)-5-ethyl-2-methylpiperidine-1-carbohydrazide (PubChem CID 130697867) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is (2S,5R)-5-ethyl-2-methylpiperidine-1-carbohydrazide.
| Compound Name | (2S,5R)-5-ethyl-2-methylpiperidine-1-carbohydrazide |
|---|---|
| PubChem CID | 130697867 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | (2S,5R)-5-ethyl-2-methylpiperidine-1-carbohydrazide |
| SMILES | CC[C@@H]1CC[C@H](C)N(C(=O)NN)C1 |
| InChI | InChI=1S/C9H19N3O/c1-3-8-5-4-7(2)12(6-8)9(13)11-10/h7-8H,3-6,10H2,1-2H3,(H,11,13)/t7-,8+/m0/s1 |
| InChIKey | UCAPWRUGOSRRTC-JGVFFNPUSA-N |
| XLogP | 1.08 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|