C9H13NOS — CID 130699304
(1-ethylcyclopropyl)-(1,2-thiazol-3-yl)methanol (PubChem CID 130699304) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is (1-ethylcyclopropyl)-(1,2-thiazol-3-yl)methanol.
| Compound Name | (1-ethylcyclopropyl)-(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 130699304 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | (1-ethylcyclopropyl)-(1,2-thiazol-3-yl)methanol |
| SMILES | CCC1(C(O)c2ccsn2)CC1 |
| InChI | InChI=1S/C9H13NOS/c1-2-9(4-5-9)8(11)7-3-6-12-10-7/h3,6,8,11H,2,4-5H2,1H3 |
| InChIKey | LIAAKDRVDZKEFI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |