About N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine
N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine (PubChem CID 130700379) has the molecular formula C8H11F2N3
and a molecular weight of 187.19 g/mol. Its IUPAC name is N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine |
| PubChem CID | 130700379 |
| Molecular Formula | C8H11F2N3 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine |
| SMILES | Cc1nccc(NCCC(F)F)n1 |
| InChI | InChI=1S/C8H11F2N3/c1-6-11-5-3-8(13-6)12-4-2-7(9)10/h3,5,7H,2,4H2,1H3,(H,11,12,13) |
| InChIKey | YCEGPNKVTGIEFK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine?
The IUPAC name of N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine (CID 130700379) is N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine.
What is the SMILES notation for N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine?
The canonical SMILES for N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine is Cc1nccc(NCCC(F)F)n1.
What is the InChIKey of N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine?
The InChIKey is YCEGPNKVTGIEFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3/c1-6-11-5-3-8(13-6)12-4-2-7(9)10/h3,5,7H,2,4H2,1H3,(H,11,12,13).
What are the key properties of N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine?
N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine has a molecular weight of 187.19 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluoropropyl)-2-methylpyrimidin-4-amine is sourced from PubChem (CID 130700379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).