About (5-fluoro-3-pyridinyl) carbonochloridate
(5-fluoro-3-pyridinyl) carbonochloridate (PubChem CID 130700465) has the molecular formula C6H3ClFNO2
and a molecular weight of 175.55 g/mol. Its IUPAC name is (5-fluoro-3-pyridinyl) carbonochloridate.
Molecular Properties
| Compound Name | (5-fluoro-3-pyridinyl) carbonochloridate |
| PubChem CID | 130700465 |
| Molecular Formula | C6H3ClFNO2 |
| Molecular Weight | 175.55 g/mol |
| Exact Mass | 174.98 |
| IUPAC Name | (5-fluoro-3-pyridinyl) carbonochloridate |
| SMILES | O=C(Cl)Oc1cncc(F)c1 |
| InChI | InChI=1S/C6H3ClFNO2/c7-6(10)11-5-1-4(8)2-9-3-5/h1-3H |
| InChIKey | IVEWHGPEZAATAP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.55 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-3-pyridinyl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-3-pyridinyl) carbonochloridate?
The IUPAC name of (5-fluoro-3-pyridinyl) carbonochloridate (CID 130700465) is (5-fluoro-3-pyridinyl) carbonochloridate.
What is the SMILES notation for (5-fluoro-3-pyridinyl) carbonochloridate?
The canonical SMILES for (5-fluoro-3-pyridinyl) carbonochloridate is O=C(Cl)Oc1cncc(F)c1.
What is the InChIKey of (5-fluoro-3-pyridinyl) carbonochloridate?
The InChIKey is IVEWHGPEZAATAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClFNO2/c7-6(10)11-5-1-4(8)2-9-3-5/h1-3H.
What are the key properties of (5-fluoro-3-pyridinyl) carbonochloridate?
(5-fluoro-3-pyridinyl) carbonochloridate has a molecular weight of 175.55 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-3-pyridinyl) carbonochloridate is sourced from PubChem (CID 130700465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).