About [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine
[1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine (PubChem CID 130700544) has the molecular formula C7H9N5S
and a molecular weight of 195.25 g/mol. Its IUPAC name is [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine.
Molecular Properties
| Compound Name | [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine |
| PubChem CID | 130700544 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine |
| SMILES | NNC(c1cn[nH]c1)c1ccsn1 |
| InChI | InChI=1S/C7H9N5S/c8-11-7(5-3-9-10-4-5)6-1-2-13-12-6/h1-4,7,11H,8H2,(H,9,10) |
| InChIKey | MBIQUCVUXVNSPT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine?
The IUPAC name of [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine (CID 130700544) is [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine.
What is the SMILES notation for [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine?
The canonical SMILES for [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine is NNC(c1cn[nH]c1)c1ccsn1.
What is the InChIKey of [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine?
The InChIKey is MBIQUCVUXVNSPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5S/c8-11-7(5-3-9-10-4-5)6-1-2-13-12-6/h1-4,7,11H,8H2,(H,9,10).
What are the key properties of [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine?
[1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine has a molecular weight of 195.25 g/mol, XLogP of 0.42, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1H-pyrazol-4-yl(1,2-thiazol-3-yl)methyl]hydrazine is sourced from PubChem (CID 130700544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).