About 2-aminoethanesulfonic acid;N,N-diethylethanamine
2-aminoethanesulfonic acid;N,N-diethylethanamine (PubChem CID 13070088) has the molecular formula C8H22N2O3S
and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-aminoethanesulfonic acid;N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-aminoethanesulfonic acid;N,N-diethylethanamine |
| PubChem CID | 13070088 |
| Molecular Formula | C8H22N2O3S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2-aminoethanesulfonic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.NCCS(=O)(=O)O |
| InChI | InChI=1S/C6H15N.C2H7NO3S/c1-4-7(5-2)6-3;3-1-2-7(4,5)6/h4-6H2,1-3H3;1-3H2,(H,4,5,6) |
| InChIKey | OFGSMYBENDTHEF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanesulfonic acid;N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanesulfonic acid;N,N-diethylethanamine?
The IUPAC name of 2-aminoethanesulfonic acid;N,N-diethylethanamine (CID 13070088) is 2-aminoethanesulfonic acid;N,N-diethylethanamine.
What is the SMILES notation for 2-aminoethanesulfonic acid;N,N-diethylethanamine?
The canonical SMILES for 2-aminoethanesulfonic acid;N,N-diethylethanamine is CCN(CC)CC.NCCS(=O)(=O)O.
What is the InChIKey of 2-aminoethanesulfonic acid;N,N-diethylethanamine?
The InChIKey is OFGSMYBENDTHEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C2H7NO3S/c1-4-7(5-2)6-3;3-1-2-7(4,5)6/h4-6H2,1-3H3;1-3H2,(H,4,5,6).
What are the key properties of 2-aminoethanesulfonic acid;N,N-diethylethanamine?
2-aminoethanesulfonic acid;N,N-diethylethanamine has a molecular weight of 226.34 g/mol, XLogP of 0.18, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanesulfonic acid;N,N-diethylethanamine is sourced from PubChem (CID 13070088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).