C8H17N3 — CID 130701599
1,1,2-trimethyl-3-(2-methylprop-2-enyl)guanidine (PubChem CID 130701599) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-(2-methylprop-2-enyl)guanidine.
| Compound Name | 1,1,2-trimethyl-3-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 130701599 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 1,1,2-trimethyl-3-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)CN/C(=N/C)N(C)C |
| InChI | InChI=1S/C8H17N3/c1-7(2)6-10-8(9-3)11(4)5/h1,6H2,2-5H3,(H,9,10) |
| InChIKey | BWHWISRJHAZVOR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|