C9H14N4O — CID 130701737
4-amino-N-butan-2-ylpyrimidine-2-carboxamide (PubChem CID 130701737) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 4-amino-N-butan-2-ylpyrimidine-2-carboxamide.
| Compound Name | 4-amino-N-butan-2-ylpyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 130701737 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 4-amino-N-butan-2-ylpyrimidine-2-carboxamide |
| SMILES | CCC(C)NC(=O)c1nccc(N)n1 |
| InChI | InChI=1S/C9H14N4O/c1-3-6(2)12-9(14)8-11-5-4-7(10)13-8/h4-6H,3H2,1-2H3,(H,12,14)(H2,10,11,13) |
| InChIKey | FEMIERRYPDNSAX-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |