About 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile
4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile (PubChem CID 130701760) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile.
Molecular Properties
| Compound Name | 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile |
| PubChem CID | 130701760 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile |
| SMILES | CN1CCN=C1NCCCC#N |
| InChI | InChI=1S/C8H14N4/c1-12-7-6-11-8(12)10-5-3-2-4-9/h2-3,5-7H2,1H3,(H,10,11) |
| InChIKey | MHDVFMXDXLBWKD-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile?
The IUPAC name of 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile (CID 130701760) is 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile.
What is the SMILES notation for 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile?
The canonical SMILES for 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile is CN1CCN=C1NCCCC#N.
What is the InChIKey of 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile?
The InChIKey is MHDVFMXDXLBWKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c1-12-7-6-11-8(12)10-5-3-2-4-9/h2-3,5-7H2,1H3,(H,10,11).
What are the key properties of 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile?
4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile has a molecular weight of 166.23 g/mol, XLogP of 0.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-methyl-4,5-dihydroimidazol-2-yl)amino]butanenitrile is sourced from PubChem (CID 130701760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).