About 1-butyl-2,5-dimethylpiperidine
1-butyl-2,5-dimethylpiperidine (PubChem CID 130702123) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is 1-butyl-2,5-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-butyl-2,5-dimethylpiperidine |
| PubChem CID | 130702123 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 1-butyl-2,5-dimethylpiperidine |
| SMILES | CCCCN1CC(C)CCC1C |
| InChI | InChI=1S/C11H23N/c1-4-5-8-12-9-10(2)6-7-11(12)3/h10-11H,4-9H2,1-3H3 |
| InChIKey | CZUSALZBMJJOQH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butyl-2,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2,5-dimethylpiperidine?
The IUPAC name of 1-butyl-2,5-dimethylpiperidine (CID 130702123) is 1-butyl-2,5-dimethylpiperidine.
What is the SMILES notation for 1-butyl-2,5-dimethylpiperidine?
The canonical SMILES for 1-butyl-2,5-dimethylpiperidine is CCCCN1CC(C)CCC1C.
What is the InChIKey of 1-butyl-2,5-dimethylpiperidine?
The InChIKey is CZUSALZBMJJOQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N/c1-4-5-8-12-9-10(2)6-7-11(12)3/h10-11H,4-9H2,1-3H3.
What are the key properties of 1-butyl-2,5-dimethylpiperidine?
1-butyl-2,5-dimethylpiperidine has a molecular weight of 169.31 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2,5-dimethylpiperidine is sourced from PubChem (CID 130702123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).