About 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide
3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide (PubChem CID 130702489) has the molecular formula C6H7ClN2O2S
and a molecular weight of 206.65 g/mol. Its IUPAC name is 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide |
| PubChem CID | 130702489 |
| Molecular Formula | C6H7ClN2O2S |
| Molecular Weight | 206.65 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide |
| SMILES | CCONC(=O)c1cc(Cl)ns1 |
| InChI | InChI=1S/C6H7ClN2O2S/c1-2-11-8-6(10)4-3-5(7)9-12-4/h3H,2H2,1H3,(H,8,10) |
| InChIKey | UPNIJRSHMORPAA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.65 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide?
The IUPAC name of 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide (CID 130702489) is 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide.
What is the SMILES notation for 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide?
The canonical SMILES for 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide is CCONC(=O)c1cc(Cl)ns1.
What is the InChIKey of 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide?
The InChIKey is UPNIJRSHMORPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2S/c1-2-11-8-6(10)4-3-5(7)9-12-4/h3H,2H2,1H3,(H,8,10).
What are the key properties of 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide?
3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide has a molecular weight of 206.65 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-ethoxy-1,2-thiazole-5-carboxamide is sourced from PubChem (CID 130702489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).