About 4-(2-methylidenebutyl)-1,4-thiazepane
4-(2-methylidenebutyl)-1,4-thiazepane (PubChem CID 130702968) has the molecular formula C10H19NS
and a molecular weight of 185.34 g/mol. Its IUPAC name is 4-(2-methylidenebutyl)-1,4-thiazepane.
Molecular Properties
| Compound Name | 4-(2-methylidenebutyl)-1,4-thiazepane |
| PubChem CID | 130702968 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-(2-methylidenebutyl)-1,4-thiazepane |
| SMILES | C=C(CC)CN1CCCSCC1 |
| InChI | InChI=1S/C10H19NS/c1-3-10(2)9-11-5-4-7-12-8-6-11/h2-9H2,1H3 |
| InChIKey | WKLMTXSRMYJVGG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylidenebutyl)-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylidenebutyl)-1,4-thiazepane?
The IUPAC name of 4-(2-methylidenebutyl)-1,4-thiazepane (CID 130702968) is 4-(2-methylidenebutyl)-1,4-thiazepane.
What is the SMILES notation for 4-(2-methylidenebutyl)-1,4-thiazepane?
The canonical SMILES for 4-(2-methylidenebutyl)-1,4-thiazepane is C=C(CC)CN1CCCSCC1.
What is the InChIKey of 4-(2-methylidenebutyl)-1,4-thiazepane?
The InChIKey is WKLMTXSRMYJVGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NS/c1-3-10(2)9-11-5-4-7-12-8-6-11/h2-9H2,1H3.
What are the key properties of 4-(2-methylidenebutyl)-1,4-thiazepane?
4-(2-methylidenebutyl)-1,4-thiazepane has a molecular weight of 185.34 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylidenebutyl)-1,4-thiazepane is sourced from PubChem (CID 130702968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).