About methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate
methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate (PubChem CID 130703206) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate.
Analyze methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate?
The IUPAC name of methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate (CID 130703206) is methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate.
What is the SMILES notation for methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate?
The canonical SMILES for methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate is COC(=O)c1oc(C2CC2)nc1C.
What is the InChIKey of methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate?
The InChIKey is YPLUOMCEAUJOGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-5-7(9(11)12-2)13-8(10-5)6-3-4-6/h6H,3-4H2,1-2H3.
What are the key properties of methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate?
methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate has a molecular weight of 181.19 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyclopropyl-4-methyl-1,3-oxazole-5-carboxylate is sourced from PubChem (CID 130703206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).