About 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine
3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine (PubChem CID 130705310) has the molecular formula C5H12N6
and a molecular weight of 156.19 g/mol. Its IUPAC name is 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine |
| PubChem CID | 130705310 |
| Molecular Formula | C5H12N6 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine |
| SMILES | CCCc1nnc(NN)n1N |
| InChI | InChI=1S/C5H12N6/c1-2-3-4-9-10-5(8-6)11(4)7/h2-3,6-7H2,1H3,(H,8,10) |
| InChIKey | AFZXKZINBBGMDK-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine?
The IUPAC name of 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine (CID 130705310) is 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine.
What is the SMILES notation for 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine?
The canonical SMILES for 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine is CCCc1nnc(NN)n1N.
What is the InChIKey of 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine?
The InChIKey is AFZXKZINBBGMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N6/c1-2-3-4-9-10-5(8-6)11(4)7/h2-3,6-7H2,1H3,(H,8,10).
What are the key properties of 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine?
3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine has a molecular weight of 156.19 g/mol, XLogP of -0.77, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydrazinyl-5-propyl-1,2,4-triazol-4-amine is sourced from PubChem (CID 130705310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).