About 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole
2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole (PubChem CID 130706011) has the molecular formula C9H13F2N3
and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole |
| PubChem CID | 130706011 |
| Molecular Formula | C9H13F2N3 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole |
| SMILES | CCc1cnc(N2CCC(F)(F)C2)[nH]1 |
| InChI | InChI=1S/C9H13F2N3/c1-2-7-5-12-8(13-7)14-4-3-9(10,11)6-14/h5H,2-4,6H2,1H3,(H,12,13) |
| InChIKey | CVNIYWYSNFLVKV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole?
The IUPAC name of 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole (CID 130706011) is 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole.
What is the SMILES notation for 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole?
The canonical SMILES for 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole is CCc1cnc(N2CCC(F)(F)C2)[nH]1.
What is the InChIKey of 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole?
The InChIKey is CVNIYWYSNFLVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3/c1-2-7-5-12-8(13-7)14-4-3-9(10,11)6-14/h5H,2-4,6H2,1H3,(H,12,13).
What are the key properties of 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole?
2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole has a molecular weight of 201.22 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-difluoropyrrolidin-1-yl)-5-ethyl-1H-imidazole is sourced from PubChem (CID 130706011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).