C11H13FIN — CID 130706080
(1R)-6-fluoro-8-iodo-7-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 130706080) has the molecular formula C11H13FIN and a molecular weight of 305.13 g/mol. Its IUPAC name is (1R)-6-fluoro-8-iodo-7-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-6-fluoro-8-iodo-7-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 130706080 |
| Molecular Formula | C11H13FIN |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | (1R)-6-fluoro-8-iodo-7-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | Cc1c(F)cc2c(c1I)[C@H](N)CCC2 |
| InChI | InChI=1S/C11H13FIN/c1-6-8(12)5-7-3-2-4-9(14)10(7)11(6)13/h5,9H,2-4,14H2,1H3/t9-/m1/s1 |
| InChIKey | MXWUOOLVWAJINR-SECBINFHSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|