About (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine
(1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine (PubChem CID 130706401) has the molecular formula C11H18N2S
and a molecular weight of 210.35 g/mol. Its IUPAC name is (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine |
| PubChem CID | 130706401 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine |
| SMILES | CCC1(C(N)c2ccsn2)CCCC1 |
| InChI | InChI=1S/C11H18N2S/c1-2-11(6-3-4-7-11)10(12)9-5-8-14-13-9/h5,8,10H,2-4,6-7,12H2,1H3 |
| InChIKey | GXJLXESYOLUJQY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine?
The IUPAC name of (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine (CID 130706401) is (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine.
What is the SMILES notation for (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine?
The canonical SMILES for (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine is CCC1(C(N)c2ccsn2)CCCC1.
What is the InChIKey of (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine?
The InChIKey is GXJLXESYOLUJQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2S/c1-2-11(6-3-4-7-11)10(12)9-5-8-14-13-9/h5,8,10H,2-4,6-7,12H2,1H3.
What are the key properties of (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine?
(1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine has a molecular weight of 210.35 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl)-(1,2-thiazol-3-yl)methanamine is sourced from PubChem (CID 130706401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).